C21H16ClN3O2 — CID 2894714
3-[(2-phenylquinazolin-4-yl)amino]benzoic acid;hydrochloride (PubChem CID 2894714) has the molecular formula C21H16ClN3O2 and a molecular weight of 377.83 g/mol. Its IUPAC name is 3-[(2-phenylquinazolin-4-yl)amino]benzoic acid;hydrochloride.
| Compound Name | 3-[(2-phenylquinazolin-4-yl)amino]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 2894714 |
| Molecular Formula | C21H16ClN3O2 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 3-[(2-phenylquinazolin-4-yl)amino]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1cccc(Nc2nc(-c3ccccc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C21H15N3O2.ClH/c25-21(26)15-9-6-10-16(13-15)22-20-17-11-4-5-12-18(17)23-19(24-20)14-7-2-1-3-8-14;/h1-13H,(H,25,26)(H,22,23,24);1H |
| InChIKey | HTBVZMCJEBJUME-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |