C22H18N4O3 — CID 71691164
3-[[4-(4-methoxyanilino)quinazolin-2-yl]amino]benzoic acid (PubChem CID 71691164) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is 3-[[4-(4-methoxyanilino)quinazolin-2-yl]amino]benzoic acid.
| Compound Name | 3-[[4-(4-methoxyanilino)quinazolin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 71691164 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 3-[[4-(4-methoxyanilino)quinazolin-2-yl]amino]benzoic acid |
| SMILES | COc1ccc(Nc2nc(Nc3cccc(C(=O)O)c3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C22H18N4O3/c1-29-17-11-9-15(10-12-17)23-20-18-7-2-3-8-19(18)25-22(26-20)24-16-6-4-5-14(13-16)21(27)28/h2-13H,1H3,(H,27,28)(H2,23,24,25,26) |
| InChIKey | BNCBBWLBRNTDPJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |