C23H23N5O3S — CID 54460110
N-[[4-[[4-(3-methoxyanilino)quinazolin-2-yl]amino]phenyl]methyl]methanesulfonamide (PubChem CID 54460110) has the molecular formula C23H23N5O3S and a molecular weight of 449.54 g/mol. Its IUPAC name is N-[[4-[[4-(3-methoxyanilino)quinazolin-2-yl]amino]phenyl]methyl]methanesulfonamide.
| Compound Name | N-[[4-[[4-(3-methoxyanilino)quinazolin-2-yl]amino]phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 54460110 |
| Molecular Formula | C23H23N5O3S |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-[[4-[[4-(3-methoxyanilino)quinazolin-2-yl]amino]phenyl]methyl]methanesulfonamide |
| SMILES | COc1cccc(Nc2nc(Nc3ccc(CNS(C)(=O)=O)cc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C23H23N5O3S/c1-31-19-7-5-6-18(14-19)25-22-20-8-3-4-9-21(20)27-23(28-22)26-17-12-10-16(11-13-17)15-24-32(2,29)30/h3-14,24H,15H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | XBANUEHKNKDNBH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |