C24H25ClN4O3 — CID 67725035
2-N-[4-(2-methoxyethoxy)phenyl]-4-N-(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride (PubChem CID 67725035) has the molecular formula C24H25ClN4O3 and a molecular weight of 452.94 g/mol. Its IUPAC name is 2-N-[4-(2-methoxyethoxy)phenyl]-4-N-(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride.
| Compound Name | 2-N-[4-(2-methoxyethoxy)phenyl]-4-N-(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 67725035 |
| Molecular Formula | C24H25ClN4O3 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 2-N-[4-(2-methoxyethoxy)phenyl]-4-N-(4-methoxyphenyl)quinazoline-2,4-diamine;hydrochloride |
| SMILES | COCCOc1ccc(Nc2nc(Nc3ccc(OC)cc3)c3ccccc3n2)cc1.Cl |
| InChI | InChI=1S/C24H24N4O3.ClH/c1-29-15-16-31-20-13-9-18(10-14-20)26-24-27-22-6-4-3-5-21(22)23(28-24)25-17-7-11-19(30-2)12-8-17;/h3-14H,15-16H2,1-2H3,(H2,25,26,27,28);1H |
| InChIKey | CSHNNRIJBNKNTL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|