C19H23N5O — CID 91963816
2-N-[4-(dimethylamino)phenyl]-4-N-(2-methoxyethyl)quinazoline-2,4-diamine (PubChem CID 91963816) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-N-[4-(dimethylamino)phenyl]-4-N-(2-methoxyethyl)quinazoline-2,4-diamine.
| Compound Name | 2-N-[4-(dimethylamino)phenyl]-4-N-(2-methoxyethyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 91963816 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-N-[4-(dimethylamino)phenyl]-4-N-(2-methoxyethyl)quinazoline-2,4-diamine |
| SMILES | COCCNc1nc(Nc2ccc(N(C)C)cc2)nc2ccccc12 |
| InChI | InChI=1S/C19H23N5O/c1-24(2)15-10-8-14(9-11-15)21-19-22-17-7-5-4-6-16(17)18(23-19)20-12-13-25-3/h4-11H,12-13H2,1-3H3,(H2,20,21,22,23) |
| InChIKey | IMEJDTOGGVMDIJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|