C18H19ClN4O2 — CID 91964049
2-N-(3-chloro-4-methoxyphenyl)-4-N-(2-methoxyethyl)quinazoline-2,4-diamine (PubChem CID 91964049) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is 2-N-(3-chloro-4-methoxyphenyl)-4-N-(2-methoxyethyl)quinazoline-2,4-diamine.
| Compound Name | 2-N-(3-chloro-4-methoxyphenyl)-4-N-(2-methoxyethyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 91964049 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-N-(3-chloro-4-methoxyphenyl)-4-N-(2-methoxyethyl)quinazoline-2,4-diamine |
| SMILES | COCCNc1nc(Nc2ccc(OC)c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C18H19ClN4O2/c1-24-10-9-20-17-13-5-3-4-6-15(13)22-18(23-17)21-12-7-8-16(25-2)14(19)11-12/h3-8,11H,9-10H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | VNXWMIGLIJFEML-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|