C20H17ClN4O — CID 39861431
2-N-(3-chloro-4-methylphenyl)-4-N-(furan-2-ylmethyl)quinazoline-2,4-diamine (PubChem CID 39861431) has the molecular formula C20H17ClN4O and a molecular weight of 364.84 g/mol. Its IUPAC name is 2-N-(3-chloro-4-methylphenyl)-4-N-(furan-2-ylmethyl)quinazoline-2,4-diamine.
| Compound Name | 2-N-(3-chloro-4-methylphenyl)-4-N-(furan-2-ylmethyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 39861431 |
| Molecular Formula | C20H17ClN4O |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-N-(3-chloro-4-methylphenyl)-4-N-(furan-2-ylmethyl)quinazoline-2,4-diamine |
| SMILES | Cc1ccc(Nc2nc(NCc3ccco3)c3ccccc3n2)cc1Cl |
| InChI | InChI=1S/C20H17ClN4O/c1-13-8-9-14(11-17(13)21)23-20-24-18-7-3-2-6-16(18)19(25-20)22-12-15-5-4-10-26-15/h2-11H,12H2,1H3,(H2,22,23,24,25) |
| InChIKey | ZQDFXZJCRHJPBQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 62.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'melamine_A(3)', 'substructure': 'N/A'} |
|---|