C21H18N4O3 — CID 11689305
methyl 4-[[4-(furan-2-ylmethylamino)quinazolin-2-yl]amino]benzoate (PubChem CID 11689305) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is methyl 4-[[4-(furan-2-ylmethylamino)quinazolin-2-yl]amino]benzoate.
| Compound Name | methyl 4-[[4-(furan-2-ylmethylamino)quinazolin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 11689305 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | methyl 4-[[4-(furan-2-ylmethylamino)quinazolin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2nc(NCc3ccco3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C21H18N4O3/c1-27-20(26)14-8-10-15(11-9-14)23-21-24-18-7-3-2-6-17(18)19(25-21)22-13-16-5-4-12-28-16/h2-12H,13H2,1H3,(H2,22,23,24,25) |
| InChIKey | NLWNHIHPTQDHSU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |