C19H21ClN4O2 — CID 52996217
1-[4-[[4-(3-hydroxypropylamino)quinazolin-2-yl]amino]phenyl]ethanone;hydrochloride (PubChem CID 52996217) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 1-[4-[[4-(3-hydroxypropylamino)quinazolin-2-yl]amino]phenyl]ethanone;hydrochloride.
| Compound Name | 1-[4-[[4-(3-hydroxypropylamino)quinazolin-2-yl]amino]phenyl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 52996217 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-[4-[[4-(3-hydroxypropylamino)quinazolin-2-yl]amino]phenyl]ethanone;hydrochloride |
| SMILES | CC(=O)c1ccc(Nc2nc(NCCCO)c3ccccc3n2)cc1.Cl |
| InChI | InChI=1S/C19H20N4O2.ClH/c1-13(25)14-7-9-15(10-8-14)21-19-22-17-6-3-2-5-16(17)18(23-19)20-11-4-12-24;/h2-3,5-10,24H,4,11-12H2,1H3,(H2,20,21,22,23);1H |
| InChIKey | GQWONDSJHMTZDO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|