C20H23N5O2 — CID 91963933
2-[[2-[4-(diethylamino)anilino]quinazolin-4-yl]amino]acetic acid (PubChem CID 91963933) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-[[2-[4-(diethylamino)anilino]quinazolin-4-yl]amino]acetic acid.
| Compound Name | 2-[[2-[4-(diethylamino)anilino]quinazolin-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 91963933 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 2-[[2-[4-(diethylamino)anilino]quinazolin-4-yl]amino]acetic acid |
| SMILES | CCN(CC)c1ccc(Nc2nc(NCC(=O)O)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C20H23N5O2/c1-3-25(4-2)15-11-9-14(10-12-15)22-20-23-17-8-6-5-7-16(17)19(24-20)21-13-18(26)27/h5-12H,3-4,13H2,1-2H3,(H,26,27)(H2,21,22,23,24) |
| InChIKey | SACIVIYAYNHJTI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|