C17H18N4O2 — CID 50945420
4-[[4-(3-hydroxypropylamino)quinazolin-2-yl]amino]phenol (PubChem CID 50945420) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 4-[[4-(3-hydroxypropylamino)quinazolin-2-yl]amino]phenol.
| Compound Name | 4-[[4-(3-hydroxypropylamino)quinazolin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 50945420 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-[[4-(3-hydroxypropylamino)quinazolin-2-yl]amino]phenol |
| SMILES | OCCCNc1nc(Nc2ccc(O)cc2)nc2ccccc12 |
| InChI | InChI=1S/C17H18N4O2/c22-11-3-10-18-16-14-4-1-2-5-15(14)20-17(21-16)19-12-6-8-13(23)9-7-12/h1-2,4-9,22-23H,3,10-11H2,(H2,18,19,20,21) |
| InChIKey | XSOYBGFWFMMSRP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|