C17H15F3N4O — CID 50944549
2-[[2-[3-(trifluoromethyl)anilino]quinazolin-4-yl]amino]ethanol (PubChem CID 50944549) has the molecular formula C17H15F3N4O and a molecular weight of 348.33 g/mol. Its IUPAC name is 2-[[2-[3-(trifluoromethyl)anilino]quinazolin-4-yl]amino]ethanol.
| Compound Name | 2-[[2-[3-(trifluoromethyl)anilino]quinazolin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 50944549 |
| Molecular Formula | C17H15F3N4O |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-[[2-[3-(trifluoromethyl)anilino]quinazolin-4-yl]amino]ethanol |
| SMILES | OCCNc1nc(Nc2cccc(C(F)(F)F)c2)nc2ccccc12 |
| InChI | InChI=1S/C17H15F3N4O/c18-17(19,20)11-4-3-5-12(10-11)22-16-23-14-7-2-1-6-13(14)15(24-16)21-8-9-25/h1-7,10,25H,8-9H2,(H2,21,22,23,24) |
| InChIKey | ZLGBDRVTAVTGQB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |