C25H23ClF3N3 — CID 2790095
2-(4-tert-butylphenyl)-N-[3-(trifluoromethyl)phenyl]quinazolin-4-amine;hydrochloride (PubChem CID 2790095) has the molecular formula C25H23ClF3N3 and a molecular weight of 457.93 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-[3-(trifluoromethyl)phenyl]quinazolin-4-amine;hydrochloride.
| Compound Name | 2-(4-tert-butylphenyl)-N-[3-(trifluoromethyl)phenyl]quinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 2790095 |
| Molecular Formula | C25H23ClF3N3 |
| Molecular Weight | 457.93 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-[3-(trifluoromethyl)phenyl]quinazolin-4-amine;hydrochloride |
| SMILES | CC(C)(C)c1ccc(-c2nc(Nc3cccc(C(F)(F)F)c3)c3ccccc3n2)cc1.Cl |
| InChI | InChI=1S/C25H22F3N3.ClH/c1-24(2,3)17-13-11-16(12-14-17)22-30-21-10-5-4-9-20(21)23(31-22)29-19-8-6-7-18(15-19)25(26,27)28;/h4-15H,1-3H3,(H,29,30,31);1H |
| InChIKey | DPSFBOSUSUPKJR-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.93 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |