C20H16F3N3O3S — CID 167993363
1-[4-methylsulfonyl-2-phenyl-6-[3-(trifluoromethyl)anilino]pyrimidin-5-yl]ethanone (PubChem CID 167993363) has the molecular formula C20H16F3N3O3S and a molecular weight of 435.43 g/mol. Its IUPAC name is 1-[4-methylsulfonyl-2-phenyl-6-[3-(trifluoromethyl)anilino]pyrimidin-5-yl]ethanone.
| Compound Name | 1-[4-methylsulfonyl-2-phenyl-6-[3-(trifluoromethyl)anilino]pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 167993363 |
| Molecular Formula | C20H16F3N3O3S |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 1-[4-methylsulfonyl-2-phenyl-6-[3-(trifluoromethyl)anilino]pyrimidin-5-yl]ethanone |
| SMILES | CC(=O)c1c(Nc2cccc(C(F)(F)F)c2)nc(-c2ccccc2)nc1S(C)(=O)=O |
| InChI | InChI=1S/C20H16F3N3O3S/c1-12(27)16-18(24-15-10-6-9-14(11-15)20(21,22)23)25-17(13-7-4-3-5-8-13)26-19(16)30(2,28)29/h3-11H,1-2H3,(H,24,25,26) |
| InChIKey | FOQGWRBVTDKKDK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |