C21H23F3N2O2S — CID 156795689
ethane;3-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]benzoic acid (PubChem CID 156795689) has the molecular formula C21H23F3N2O2S and a molecular weight of 424.49 g/mol. Its IUPAC name is ethane;3-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]benzoic acid.
| Compound Name | ethane;3-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 156795689 |
| Molecular Formula | C21H23F3N2O2S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | ethane;3-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]benzoic acid |
| SMILES | CC.CC.O=C(O)c1cccc(-c2csc(Nc3cccc(C(F)(F)F)c3)n2)c1 |
| InChI | InChI=1S/C17H11F3N2O2S.2C2H6/c18-17(19,20)12-5-2-6-13(8-12)21-16-22-14(9-25-16)10-3-1-4-11(7-10)15(23)24;2*1-2/h1-9H,(H,21,22)(H,23,24);2*1-2H3 |
| InChIKey | MHLDQKCXIGKOMQ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |