C17H11N3O2S — CID 156518211
3-[[4-(3-cyanophenyl)-1,3-thiazol-2-yl]amino]benzoic acid (PubChem CID 156518211) has the molecular formula C17H11N3O2S and a molecular weight of 321.36 g/mol. Its IUPAC name is 3-[[4-(3-cyanophenyl)-1,3-thiazol-2-yl]amino]benzoic acid.
| Compound Name | 3-[[4-(3-cyanophenyl)-1,3-thiazol-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 156518211 |
| Molecular Formula | C17H11N3O2S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-[[4-(3-cyanophenyl)-1,3-thiazol-2-yl]amino]benzoic acid |
| SMILES | N#Cc1cccc(-c2csc(Nc3cccc(C(=O)O)c3)n2)c1 |
| InChI | InChI=1S/C17H11N3O2S/c18-9-11-3-1-4-12(7-11)15-10-23-17(20-15)19-14-6-2-5-13(8-14)16(21)22/h1-8,10H,(H,19,20)(H,21,22) |
| InChIKey | JDXBAHDMPIYERX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |