C23H16N6OS — CID 158426483
3-acetylbenzonitrile;3-[2-(pyrazin-2-ylamino)-1,3-thiazol-4-yl]benzonitrile (PubChem CID 158426483) has the molecular formula C23H16N6OS and a molecular weight of 424.49 g/mol. Its IUPAC name is 3-acetylbenzonitrile;3-[2-(pyrazin-2-ylamino)-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 3-acetylbenzonitrile;3-[2-(pyrazin-2-ylamino)-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 158426483 |
| Molecular Formula | C23H16N6OS |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 3-acetylbenzonitrile;3-[2-(pyrazin-2-ylamino)-1,3-thiazol-4-yl]benzonitrile |
| SMILES | CC(=O)c1cccc(C#N)c1.N#Cc1cccc(-c2csc(Nc3cnccn3)n2)c1 |
| InChI | InChI=1S/C14H9N5S.C9H7NO/c15-7-10-2-1-3-11(6-10)12-9-20-14(18-12)19-13-8-16-4-5-17-13;1-7(11)9-4-2-3-8(5-9)6-10/h1-6,8-9H,(H,17,18,19);2-5H,1H3 |
| InChIKey | HBCNSIJDXKLZJE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |