C9H8N4OS — CID 143665651
1-[2-(pyrazin-2-ylamino)-1,3-thiazol-4-yl]ethanone (PubChem CID 143665651) has the molecular formula C9H8N4OS and a molecular weight of 220.26 g/mol. Its IUPAC name is 1-[2-(pyrazin-2-ylamino)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(pyrazin-2-ylamino)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 143665651 |
| Molecular Formula | C9H8N4OS |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 1-[2-(pyrazin-2-ylamino)-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc(Nc2cnccn2)n1 |
| InChI | InChI=1S/C9H8N4OS/c1-6(14)7-5-15-9(12-7)13-8-4-10-2-3-11-8/h2-5H,1H3,(H,11,12,13) |
| InChIKey | ZVFFXRYQJHKLEU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |