C17H15N3OS — CID 82028259
1-[4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]phenyl]ethanone (PubChem CID 82028259) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is 1-[4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]phenyl]ethanone.
| Compound Name | 1-[4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 82028259 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 1-[4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2nc(-c3cccc(N)c3)cs2)cc1 |
| InChI | InChI=1S/C17H15N3OS/c1-11(21)12-5-7-15(8-6-12)19-17-20-16(10-22-17)13-3-2-4-14(18)9-13/h2-10H,18H2,1H3,(H,19,20) |
| InChIKey | CDPWXXOZGGDWPS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|