C16H12N4S2 — CID 82028286
[4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]phenyl] thiocyanate (PubChem CID 82028286) has the molecular formula C16H12N4S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is [4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 82028286 |
| Molecular Formula | C16H12N4S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | [4-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(Nc2nc(-c3cccc(N)c3)cs2)cc1 |
| InChI | InChI=1S/C16H12N4S2/c17-10-22-14-6-4-13(5-7-14)19-16-20-15(9-21-16)11-2-1-3-12(18)8-11/h1-9H,18H2,(H,19,20) |
| InChIKey | XTIMFIRJMBRBNP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|