C18H16N6S3 — CID 142032034
S-[4-[[4-amino-5-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]amino]phenyl]thiohydroxylamine (PubChem CID 142032034) has the molecular formula C18H16N6S3 and a molecular weight of 412.57 g/mol. Its IUPAC name is S-[4-[[4-amino-5-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]amino]phenyl]thiohydroxylamine.
| Compound Name | S-[4-[[4-amino-5-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]amino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 142032034 |
| Molecular Formula | C18H16N6S3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | S-[4-[[4-amino-5-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]amino]phenyl]thiohydroxylamine |
| SMILES | NSc1ccc(Nc2nc(N)c(-c3nc(-c4cccc(N)c4)cs3)s2)cc1 |
| InChI | InChI=1S/C18H16N6S3/c19-11-3-1-2-10(8-11)14-9-25-17(23-14)15-16(20)24-18(26-15)22-12-4-6-13(27-21)7-5-12/h1-9H,19-21H2,(H,22,24) |
| InChIKey | HUYYXXNAUWTPCW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|