C17H16N2S — CID 753967
N-(3,4-dimethylphenyl)-4-phenyl-1,3-thiazol-2-amine (PubChem CID 753967) has the molecular formula C17H16N2S and a molecular weight of 280.40 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-(3,4-dimethylphenyl)-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 753967 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(Nc2nc(-c3ccccc3)cs2)cc1C |
| InChI | InChI=1S/C17H16N2S/c1-12-8-9-15(10-13(12)2)18-17-19-16(11-20-17)14-6-4-3-5-7-14/h3-11H,1-2H3,(H,18,19) |
| InChIKey | XTBIIAXZGBLOCD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |