C19H21N3S — CID 82028311
4-(4-aminophenyl)-N-(4-tert-butylphenyl)-1,3-thiazol-2-amine (PubChem CID 82028311) has the molecular formula C19H21N3S and a molecular weight of 323.47 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N-(4-tert-butylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-aminophenyl)-N-(4-tert-butylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82028311 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 4-(4-aminophenyl)-N-(4-tert-butylphenyl)-1,3-thiazol-2-amine |
| SMILES | CC(C)(C)c1ccc(Nc2nc(-c3ccc(N)cc3)cs2)cc1 |
| InChI | InChI=1S/C19H21N3S/c1-19(2,3)14-6-10-16(11-7-14)21-18-22-17(12-23-18)13-4-8-15(20)9-5-13/h4-12H,20H2,1-3H3,(H,21,22) |
| InChIKey | UYLWHVAHALSJDJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|