C17H17N3S — CID 82059186
4-N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine (PubChem CID 82059186) has the molecular formula C17H17N3S and a molecular weight of 295.41 g/mol. Its IUPAC name is 4-N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 82059186 |
| Molecular Formula | C17H17N3S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-N-[4-(2,4-dimethylphenyl)-1,3-thiazol-2-yl]benzene-1,4-diamine |
| SMILES | Cc1ccc(-c2csc(Nc3ccc(N)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C17H17N3S/c1-11-3-8-15(12(2)9-11)16-10-21-17(20-16)19-14-6-4-13(18)5-7-14/h3-10H,18H2,1-2H3,(H,19,20) |
| InChIKey | SKWZSHPEYKIBKU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|