C12H14N2S — CID 17465165
4-(2,4-dimethylphenyl)-N-methyl-1,3-thiazol-2-amine (PubChem CID 17465165) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-N-methyl-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dimethylphenyl)-N-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 17465165 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-N-methyl-1,3-thiazol-2-amine |
| SMILES | CNc1nc(-c2ccc(C)cc2C)cs1 |
| InChI | InChI=1S/C12H14N2S/c1-8-4-5-10(9(2)6-8)11-7-15-12(13-3)14-11/h4-7H,1-3H3,(H,13,14) |
| InChIKey | HAPYPSSBBJAIIT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |