C16H11F2N3OS — CID 28861611
N-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-3,4-difluorobenzamide (PubChem CID 28861611) has the molecular formula C16H11F2N3OS and a molecular weight of 331.35 g/mol. Its IUPAC name is N-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-3,4-difluorobenzamide.
| Compound Name | N-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 28861611 |
| Molecular Formula | C16H11F2N3OS |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-3,4-difluorobenzamide |
| SMILES | Nc1cccc(-c2csc(NC(=O)c3ccc(F)c(F)c3)n2)c1 |
| InChI | InChI=1S/C16H11F2N3OS/c17-12-5-4-10(7-13(12)18)15(22)21-16-20-14(8-23-16)9-2-1-3-11(19)6-9/h1-8H,19H2,(H,20,21,22) |
| InChIKey | ALCFNVLASKMGDC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|