2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid

C11H6F2N2O3S — CID 28858327

IUPAC2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid
SMILESO=C(Nc1nc(C(=O)O)cs1)c1ccc(F)c(F)c1
InChIInChI=1S/C11H6F2N2O3S/c12-6-2-1-5(3-7(6)13)9(16)15-11-14-8(4-19-11)10(17)18/h1-4H,(H,17,18)(H,14,15,16)
InChIKeyCISMECHJHMURHJ-UHFFFAOYSA-N
MW284.24 g/mol
LogP2.37
Rot. Bonds3

About 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid

2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 28858327) has the molecular formula C11H6F2N2O3S and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid
PubChem CID28858327
Molecular FormulaC11H6F2N2O3S
Molecular Weight284.24 g/mol
Exact Mass284.01
IUPAC Name2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid
SMILESO=C(Nc1nc(C(=O)O)cs1)c1ccc(F)c(F)c1
InChIInChI=1S/C11H6F2N2O3S/c12-6-2-1-5(3-7(6)13)9(16)15-11-14-8(4-19-11)10(17)18/h1-4H,(H,17,18)(H,14,15,16)
InChIKeyCISMECHJHMURHJ-UHFFFAOYSA-N
XLogP2.37
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.24
LogP ≤ 52.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid (CID 28858327) is 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid is O=C(Nc1nc(C(=O)O)cs1)c1ccc(F)c(F)c1.
What is the InChIKey of 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid?
The InChIKey is CISMECHJHMURHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F2N2O3S/c12-6-2-1-5(3-7(6)13)9(16)15-11-14-8(4-19-11)10(17)18/h1-4H,(H,17,18)(H,14,15,16).
What are the key properties of 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid?
2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid has a molecular weight of 284.24 g/mol, XLogP of 2.37, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 28858327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).