C17H11Cl2N3O2S — CID 16915105
2-[(4-chlorobenzoyl)amino]-N-(4-chlorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 16915105) has the molecular formula C17H11Cl2N3O2S and a molecular weight of 392.27 g/mol. Its IUPAC name is 2-[(4-chlorobenzoyl)amino]-N-(4-chlorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(4-chlorobenzoyl)amino]-N-(4-chlorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16915105 |
| Molecular Formula | C17H11Cl2N3O2S |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 2-[(4-chlorobenzoyl)amino]-N-(4-chlorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1nc(C(=O)Nc2ccc(Cl)cc2)cs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11Cl2N3O2S/c18-11-3-1-10(2-4-11)15(23)22-17-21-14(9-25-17)16(24)20-13-7-5-12(19)6-8-13/h1-9H,(H,20,24)(H,21,22,23) |
| InChIKey | SIXOQOMTHGJHNM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |