C18H14ClN3O2S — CID 7923619
4-acetamido-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 7923619) has the molecular formula C18H14ClN3O2S and a molecular weight of 371.85 g/mol. Its IUPAC name is 4-acetamido-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-acetamido-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 7923619 |
| Molecular Formula | C18H14ClN3O2S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 4-acetamido-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CC(=O)Nc1ccc(C(=O)Nc2nc(-c3ccc(Cl)cc3)cs2)cc1 |
| InChI | InChI=1S/C18H14ClN3O2S/c1-11(23)20-15-8-4-13(5-9-15)17(24)22-18-21-16(10-25-18)12-2-6-14(19)7-3-12/h2-10H,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | HWXDMLQDQCMPGX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |