C20H14ClN3O4S — CID 1111396
4-[[4-[4-[(4-chlorobenzoyl)amino]phenyl]-1,3-thiazol-2-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 1111396) has the molecular formula C20H14ClN3O4S and a molecular weight of 427.87 g/mol. Its IUPAC name is 4-[[4-[4-[(4-chlorobenzoyl)amino]phenyl]-1,3-thiazol-2-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[4-[4-[(4-chlorobenzoyl)amino]phenyl]-1,3-thiazol-2-yl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 1111396 |
| Molecular Formula | C20H14ClN3O4S |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 4-[[4-[4-[(4-chlorobenzoyl)amino]phenyl]-1,3-thiazol-2-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)Nc1nc(-c2ccc(NC(=O)c3ccc(Cl)cc3)cc2)cs1 |
| InChI | InChI=1S/C20H14ClN3O4S/c21-14-5-1-13(2-6-14)19(28)22-15-7-3-12(4-8-15)16-11-29-20(23-16)24-17(25)9-10-18(26)27/h1-11H,(H,22,28)(H,26,27)(H,23,24,25) |
| InChIKey | MQOLLDGZRKGSDY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|