C17H14ClN3OS — CID 46880291
4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-N-methylbenzamide (PubChem CID 46880291) has the molecular formula C17H14ClN3OS and a molecular weight of 343.84 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-N-methylbenzamide.
| Compound Name | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 46880291 |
| Molecular Formula | C17H14ClN3OS |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(Nc2nc(-c3ccc(Cl)cc3)cs2)cc1 |
| InChI | InChI=1S/C17H14ClN3OS/c1-19-16(22)12-4-8-14(9-5-12)20-17-21-15(10-23-17)11-2-6-13(18)7-3-11/h2-10H,1H3,(H,19,22)(H,20,21) |
| InChIKey | GUNNWTLARAIKMT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |