C12H9N5OS2 — CID 62056845
N-[4-(3-aminophenyl)-1,3-thiazol-2-yl]thiadiazole-5-carboxamide (PubChem CID 62056845) has the molecular formula C12H9N5OS2 and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[4-(3-aminophenyl)-1,3-thiazol-2-yl]thiadiazole-5-carboxamide.
| Compound Name | N-[4-(3-aminophenyl)-1,3-thiazol-2-yl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 62056845 |
| Molecular Formula | C12H9N5OS2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | N-[4-(3-aminophenyl)-1,3-thiazol-2-yl]thiadiazole-5-carboxamide |
| SMILES | Nc1cccc(-c2csc(NC(=O)c3cnns3)n2)c1 |
| InChI | InChI=1S/C12H9N5OS2/c13-8-3-1-2-7(4-8)9-6-19-12(15-9)16-11(18)10-5-14-17-20-10/h1-6H,13H2,(H,15,16,18) |
| InChIKey | PVNDAOLIECEPLM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|