C17H21N3O3S — CID 53323224
8-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]-8-oxooctanoic acid (PubChem CID 53323224) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 8-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]-8-oxooctanoic acid.
| Compound Name | 8-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 53323224 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 8-[[4-(3-aminophenyl)-1,3-thiazol-2-yl]amino]-8-oxooctanoic acid |
| SMILES | Nc1cccc(-c2csc(NC(=O)CCCCCCC(=O)O)n2)c1 |
| InChI | InChI=1S/C17H21N3O3S/c18-13-7-5-6-12(10-13)14-11-24-17(19-14)20-15(21)8-3-1-2-4-9-16(22)23/h5-7,10-11H,1-4,8-9,18H2,(H,22,23)(H,19,20,21) |
| InChIKey | SECJGWLVHSDCNI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|