C7H5ClN4OS2 — CID 65215041
N-[4-(chloromethyl)-1,3-thiazol-2-yl]thiadiazole-5-carboxamide (PubChem CID 65215041) has the molecular formula C7H5ClN4OS2 and a molecular weight of 260.73 g/mol. Its IUPAC name is N-[4-(chloromethyl)-1,3-thiazol-2-yl]thiadiazole-5-carboxamide.
| Compound Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 65215041 |
| Molecular Formula | C7H5ClN4OS2 |
| Molecular Weight | 260.73 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]thiadiazole-5-carboxamide |
| SMILES | O=C(Nc1nc(CCl)cs1)c1cnns1 |
| InChI | InChI=1S/C7H5ClN4OS2/c8-1-4-3-14-7(10-4)11-6(13)5-2-9-12-15-5/h2-3H,1H2,(H,10,11,13) |
| InChIKey | KJYUQRNPHXGAKL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.73 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|