C13H9ClN2OS2 — CID 61406615
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-benzothiophene-2-carboxamide (PubChem CID 61406615) has the molecular formula C13H9ClN2OS2 and a molecular weight of 308.82 g/mol. Its IUPAC name is N-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 61406615 |
| Molecular Formula | C13H9ClN2OS2 |
| Molecular Weight | 308.82 g/mol |
| Exact Mass | 307.98 |
| IUPAC Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1nc(CCl)cs1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C13H9ClN2OS2/c14-6-9-7-18-13(15-9)16-12(17)11-5-8-3-1-2-4-10(8)19-11/h1-5,7H,6H2,(H,15,16,17) |
| InChIKey | LTCIMQGJDCWNIS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.82 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|