C9H13ClN2OS — CID 43140266
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-3-methylbutanamide (PubChem CID 43140266) has the molecular formula C9H13ClN2OS and a molecular weight of 232.74 g/mol. Its IUPAC name is N-[4-(chloromethyl)-1,3-thiazol-2-yl]-3-methylbutanamide.
| Compound Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 43140266 |
| Molecular Formula | C9H13ClN2OS |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1nc(CCl)cs1 |
| InChI | InChI=1S/C9H13ClN2OS/c1-6(2)3-8(13)12-9-11-7(4-10)5-14-9/h5-6H,3-4H2,1-2H3,(H,11,12,13) |
| InChIKey | BNRGGFLUNANDSZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|