C13H13ClN2O3S — CID 108745929
N-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-(2-methoxyphenoxy)acetamide (PubChem CID 108745929) has the molecular formula C13H13ClN2O3S and a molecular weight of 312.78 g/mol. Its IUPAC name is N-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 108745929 |
| Molecular Formula | C13H13ClN2O3S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | N-[4-(chloromethyl)-1,3-thiazol-2-yl]-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)Nc1nc(CCl)cs1 |
| InChI | InChI=1S/C13H13ClN2O3S/c1-18-10-4-2-3-5-11(10)19-7-12(17)16-13-15-9(6-14)8-20-13/h2-5,8H,6-7H2,1H3,(H,15,16,17) |
| InChIKey | BHLGNFGKQWVZKP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|