C18H22N2O5S — CID 18129539
ethyl 2-[2-[[2-(2-propoxyphenoxy)acetyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 18129539) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is ethyl 2-[2-[[2-(2-propoxyphenoxy)acetyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[2-(2-propoxyphenoxy)acetyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 18129539 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | ethyl 2-[2-[[2-(2-propoxyphenoxy)acetyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCCOc1ccccc1OCC(=O)Nc1nc(CC(=O)OCC)cs1 |
| InChI | InChI=1S/C18H22N2O5S/c1-3-9-24-14-7-5-6-8-15(14)25-11-16(21)20-18-19-13(12-26-18)10-17(22)23-4-2/h5-8,12H,3-4,9-11H2,1-2H3,(H,19,20,21) |
| InChIKey | PCXKOEURISJGPW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |