C15H13Cl3N2O4S — CID 2204235
ethyl 2-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 2204235) has the molecular formula C15H13Cl3N2O4S and a molecular weight of 423.71 g/mol. Its IUPAC name is ethyl 2-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 2204235 |
| Molecular Formula | C15H13Cl3N2O4S |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | ethyl 2-[2-[[2-(2,4,5-trichlorophenoxy)acetyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)COc2cc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C15H13Cl3N2O4S/c1-2-23-14(22)3-8-7-25-15(19-8)20-13(21)6-24-12-5-10(17)9(16)4-11(12)18/h4-5,7H,2-3,6H2,1H3,(H,19,20,21) |
| InChIKey | BZHWZVWQQFCJPM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|