C18H14F2N2O3S2 — CID 16820846
N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-ethylsulfonylbenzamide (PubChem CID 16820846) has the molecular formula C18H14F2N2O3S2 and a molecular weight of 408.45 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-ethylsulfonylbenzamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-ethylsulfonylbenzamide |
|---|---|
| PubChem CID | 16820846 |
| Molecular Formula | C18H14F2N2O3S2 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-4-ethylsulfonylbenzamide |
| SMILES | CCS(=O)(=O)c1ccc(C(=O)Nc2nc(-c3ccc(F)c(F)c3)cs2)cc1 |
| InChI | InChI=1S/C18H14F2N2O3S2/c1-2-27(24,25)13-6-3-11(4-7-13)17(23)22-18-21-16(10-26-18)12-5-8-14(19)15(20)9-12/h3-10H,2H2,1H3,(H,21,22,23) |
| InChIKey | WJTMYKXFAFMZFP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |