C16H11F3N4O2S — CID 156517790
1-oxido-5-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridin-1-ium-3-carboxamide (PubChem CID 156517790) has the molecular formula C16H11F3N4O2S and a molecular weight of 380.35 g/mol. Its IUPAC name is 1-oxido-5-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-oxido-5-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 156517790 |
| Molecular Formula | C16H11F3N4O2S |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 1-oxido-5-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]pyridin-1-ium-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2csc(Nc3cccc(C(F)(F)F)c3)n2)c[n+]([O-])c1 |
| InChI | InChI=1S/C16H11F3N4O2S/c17-16(18,19)11-2-1-3-12(5-11)21-15-22-13(8-26-15)9-4-10(14(20)24)7-23(25)6-9/h1-8H,(H2,20,24)(H,21,22) |
| InChIKey | OPJDZFLRNGFROK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|