C19H13F3N2S — CID 159049155
4-(1H-inden-5-yl)-N-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 159049155) has the molecular formula C19H13F3N2S and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-(1H-inden-5-yl)-N-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 4-(1H-inden-5-yl)-N-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 159049155 |
| Molecular Formula | C19H13F3N2S |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-(1H-inden-5-yl)-N-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | FC(F)(F)c1cccc(Nc2nc(-c3ccc4c(c3)C=CC4)cs2)c1 |
| InChI | InChI=1S/C19H13F3N2S/c20-19(21,22)15-5-2-6-16(10-15)23-18-24-17(11-25-18)14-8-7-12-3-1-4-13(12)9-14/h1-2,4-11H,3H2,(H,23,24) |
| InChIKey | MXIUUDCPMJBULU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |