C22H24F3N4O2S+ — CID 156518224
trimethyl-[2-[[3-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]phenyl]carbamoyloxy]ethyl]azanium (PubChem CID 156518224) has the molecular formula C22H24F3N4O2S+ and a molecular weight of 465.52 g/mol. Its IUPAC name is trimethyl-[2-[[3-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]phenyl]carbamoyloxy]ethyl]azanium.
| Compound Name | trimethyl-[2-[[3-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]phenyl]carbamoyloxy]ethyl]azanium |
|---|---|
| PubChem CID | 156518224 |
| Molecular Formula | C22H24F3N4O2S+ |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | trimethyl-[2-[[3-[2-[3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]phenyl]carbamoyloxy]ethyl]azanium |
| SMILES | C[N+](C)(C)CCOC(=O)Nc1cccc(-c2csc(Nc3cccc(C(F)(F)F)c3)n2)c1 |
| InChI | InChI=1S/C22H23F3N4O2S/c1-29(2,3)10-11-31-21(30)27-17-8-4-6-15(12-17)19-14-32-20(28-19)26-18-9-5-7-16(13-18)22(23,24)25/h4-9,12-14H,10-11H2,1-3H3,(H-,26,27,28,30)/p+1 |
| InChIKey | GMRFLMVLIRUDEJ-UHFFFAOYSA-O |
| XLogP | 5.83 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|