C15H12F3NO3S — CID 122422474
3-methylsulfonyl-4-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 122422474) has the molecular formula C15H12F3NO3S and a molecular weight of 343.33 g/mol. Its IUPAC name is 3-methylsulfonyl-4-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-methylsulfonyl-4-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 122422474 |
| Molecular Formula | C15H12F3NO3S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 3-methylsulfonyl-4-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CS(=O)(=O)c1cc(C(N)=O)ccc1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F3NO3S/c1-23(21,22)13-8-10(14(19)20)5-6-12(13)9-3-2-4-11(7-9)15(16,17)18/h2-8H,1H3,(H2,19,20) |
| InChIKey | VDBWDNVBHGBITC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |