C14H8F5NO — CID 172648845
3,4-difluoro-5-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 172648845) has the molecular formula C14H8F5NO and a molecular weight of 301.21 g/mol. Its IUPAC name is 3,4-difluoro-5-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3,4-difluoro-5-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 172648845 |
| Molecular Formula | C14H8F5NO |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 3,4-difluoro-5-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | NC(=O)c1cc(F)c(F)c(-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C14H8F5NO/c15-11-6-8(13(20)21)5-10(12(11)16)7-2-1-3-9(4-7)14(17,18)19/h1-6H,(H2,20,21) |
| InChIKey | QCEYNZSDWRDZPS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |