C20H15F2NO2 — CID 172648851
3,4-difluoro-5-(3-phenylmethoxyphenyl)benzamide (PubChem CID 172648851) has the molecular formula C20H15F2NO2 and a molecular weight of 339.34 g/mol. Its IUPAC name is 3,4-difluoro-5-(3-phenylmethoxyphenyl)benzamide.
| Compound Name | 3,4-difluoro-5-(3-phenylmethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 172648851 |
| Molecular Formula | C20H15F2NO2 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 3,4-difluoro-5-(3-phenylmethoxyphenyl)benzamide |
| SMILES | NC(=O)c1cc(F)c(F)c(-c2cccc(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C20H15F2NO2/c21-18-11-15(20(23)24)10-17(19(18)22)14-7-4-8-16(9-14)25-12-13-5-2-1-3-6-13/h1-11H,12H2,(H2,23,24) |
| InChIKey | PHYDBOOJWUDWMM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |