C13H8ClF3N2O2 — CID 43343615
2-chloro-6-[3-(trifluoromethyl)anilino]pyridine-4-carboxylic acid (PubChem CID 43343615) has the molecular formula C13H8ClF3N2O2 and a molecular weight of 316.67 g/mol. Its IUPAC name is 2-chloro-6-[3-(trifluoromethyl)anilino]pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-[3-(trifluoromethyl)anilino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 43343615 |
| Molecular Formula | C13H8ClF3N2O2 |
| Molecular Weight | 316.67 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-chloro-6-[3-(trifluoromethyl)anilino]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)nc(Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C13H8ClF3N2O2/c14-10-4-7(12(20)21)5-11(19-10)18-9-3-1-2-8(6-9)13(15,16)17/h1-6H,(H,18,19)(H,20,21) |
| InChIKey | PHLBFXOVRPSISJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.67 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|