C19H15F3N4O2 — CID 113193482
3-[[2-methyl-6-[4-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoic acid (PubChem CID 113193482) has the molecular formula C19H15F3N4O2 and a molecular weight of 388.35 g/mol. Its IUPAC name is 3-[[2-methyl-6-[4-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 3-[[2-methyl-6-[4-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113193482 |
| Molecular Formula | C19H15F3N4O2 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-[[2-methyl-6-[4-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoic acid |
| SMILES | Cc1nc(Nc2ccc(C(F)(F)F)cc2)cc(Nc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C19H15F3N4O2/c1-11-23-16(25-14-7-5-13(6-8-14)19(20,21)22)10-17(24-11)26-15-4-2-3-12(9-15)18(27)28/h2-10H,1H3,(H,27,28)(H2,23,24,25,26) |
| InChIKey | SHBUQZMSAHFJHV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |