C18H14F3N3OS — CID 16738864
2-[4-phenyl-2-[3-(trifluoromethyl)anilino]-1,3-thiazol-5-yl]acetamide (PubChem CID 16738864) has the molecular formula C18H14F3N3OS and a molecular weight of 377.39 g/mol. Its IUPAC name is 2-[4-phenyl-2-[3-(trifluoromethyl)anilino]-1,3-thiazol-5-yl]acetamide.
| Compound Name | 2-[4-phenyl-2-[3-(trifluoromethyl)anilino]-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 16738864 |
| Molecular Formula | C18H14F3N3OS |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-[4-phenyl-2-[3-(trifluoromethyl)anilino]-1,3-thiazol-5-yl]acetamide |
| SMILES | NC(=O)Cc1sc(Nc2cccc(C(F)(F)F)c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H14F3N3OS/c19-18(20,21)12-7-4-8-13(9-12)23-17-24-16(11-5-2-1-3-6-11)14(26-17)10-15(22)25/h1-9H,10H2,(H2,22,25)(H,23,24) |
| InChIKey | MLZZSKQNDVDXTC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |