C20H20N2O2S — CID 23913706
2-[2-anilino-4-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]acetic acid (PubChem CID 23913706) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-[2-anilino-4-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]acetic acid.
| Compound Name | 2-[2-anilino-4-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 23913706 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 2-[2-anilino-4-(4-propan-2-ylphenyl)-1,3-thiazol-5-yl]acetic acid |
| SMILES | CC(C)c1ccc(-c2nc(Nc3ccccc3)sc2CC(=O)O)cc1 |
| InChI | InChI=1S/C20H20N2O2S/c1-13(2)14-8-10-15(11-9-14)19-17(12-18(23)24)25-20(22-19)21-16-6-4-3-5-7-16/h3-11,13H,12H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | YIWLLHXWBYKPQH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |